C19H25NO7 — CID 129100020
7-[[(2S)-1-[(3S)-1,3-dihydroxybutan-2-yl]oxy-1,3-dihydroxypropan-2-yl]amino]-4-[(E)-prop-1-enyl]chromen-2-one (PubChem CID 129100020) has the molecular formula C19H25NO7 and a molecular weight of 379.41 g/mol. Its IUPAC name is 7-[[(2S)-1-[(3S)-1,3-dihydroxybutan-2-yl]oxy-1,3-dihydroxypropan-2-yl]amino]-4-[(E)-prop-1-enyl]chromen-2-one.
| Compound Name | 7-[[(2S)-1-[(3S)-1,3-dihydroxybutan-2-yl]oxy-1,3-dihydroxypropan-2-yl]amino]-4-[(E)-prop-1-enyl]chromen-2-one |
|---|---|
| PubChem CID | 129100020 |
| Molecular Formula | C19H25NO7 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 7-[[(2S)-1-[(3S)-1,3-dihydroxybutan-2-yl]oxy-1,3-dihydroxypropan-2-yl]amino]-4-[(E)-prop-1-enyl]chromen-2-one |
| SMILES | C/C=C/c1cc(=O)oc2cc(N[C@@H](CO)C(O)OC(CO)[C@H](C)O)ccc12 |
| InChI | InChI=1S/C19H25NO7/c1-3-4-12-7-18(24)26-16-8-13(5-6-14(12)16)20-15(9-21)19(25)27-17(10-22)11(2)23/h3-8,11,15,17,19-23,25H,9-10H2,1-2H3/b4-3+/t11-,15-,17?,19?/m0/s1 |
| InChIKey | LPCJOHOHASEEAO-JSWPNORJSA-N |
| XLogP | 0.68 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|