About 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine
2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine (PubChem CID 129100139) has the molecular formula C13H20N2O2S
and a molecular weight of 268.38 g/mol. Its IUPAC name is 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine.
Molecular Properties
| Compound Name | 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine |
| PubChem CID | 129100139 |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine |
| SMILES | CCc1ccc2c(n1)CCN(CCS(C)(=O)=O)C2 |
| InChI | InChI=1S/C13H20N2O2S/c1-3-12-5-4-11-10-15(7-6-13(11)14-12)8-9-18(2,16)17/h4-5H,3,6-10H2,1-2H3 |
| InChIKey | MTJFDWKLIIUCJU-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine?
The IUPAC name of 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine (CID 129100139) is 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine.
What is the SMILES notation for 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine?
The canonical SMILES for 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine is CCc1ccc2c(n1)CCN(CCS(C)(=O)=O)C2.
What is the InChIKey of 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine?
The InChIKey is MTJFDWKLIIUCJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2S/c1-3-12-5-4-11-10-15(7-6-13(11)14-12)8-9-18(2,16)17/h4-5H,3,6-10H2,1-2H3.
What are the key properties of 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine?
2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine has a molecular weight of 268.38 g/mol, XLogP of 1.05, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-6-(2-methylsulfonylethyl)-7,8-dihydro-5H-1,6-naphthyridine is sourced from PubChem (CID 129100139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).