C18H22N2O5 — CID 129100328
4-ethynyl-7-[[(2R)-3,4,6-trihydroxy-5-methoxyhexan-2-yl]amino]-1H-quinolin-2-one (PubChem CID 129100328) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-ethynyl-7-[[(2R)-3,4,6-trihydroxy-5-methoxyhexan-2-yl]amino]-1H-quinolin-2-one.
| Compound Name | 4-ethynyl-7-[[(2R)-3,4,6-trihydroxy-5-methoxyhexan-2-yl]amino]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 129100328 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 4-ethynyl-7-[[(2R)-3,4,6-trihydroxy-5-methoxyhexan-2-yl]amino]-1H-quinolin-2-one |
| SMILES | C#Cc1cc(=O)[nH]c2cc(N[C@H](C)C(O)C(O)C(CO)OC)ccc12 |
| InChI | InChI=1S/C18H22N2O5/c1-4-11-7-16(22)20-14-8-12(5-6-13(11)14)19-10(2)17(23)18(24)15(9-21)25-3/h1,5-8,10,15,17-19,21,23-24H,9H2,2-3H3,(H,20,22)/t10-,15?,17?,18?/m1/s1 |
| InChIKey | ZMZZQVOJFDJMMK-XSVOGFJKSA-N |
| XLogP | 0.04 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|