About 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one
7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one (PubChem CID 129100341) has the molecular formula C18H20N2O5
and a molecular weight of 344.37 g/mol. Its IUPAC name is 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one |
| PubChem CID | 129100341 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one |
| SMILES | C#Cc1cc(=O)[nH]c2cc(NC3C(C)OC(CO)C(O)C3O)ccc12 |
| InChI | InChI=1S/C18H20N2O5/c1-3-10-6-15(22)20-13-7-11(4-5-12(10)13)19-16-9(2)25-14(8-21)17(23)18(16)24/h1,4-7,9,14,16-19,21,23-24H,8H2,2H3,(H,20,22) |
| InChIKey | QTWAGKWYCVOXKB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one?
The IUPAC name of 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one (CID 129100341) is 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one.
What is the SMILES notation for 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one?
The canonical SMILES for 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one is C#Cc1cc(=O)[nH]c2cc(NC3C(C)OC(CO)C(O)C3O)ccc12.
What is the InChIKey of 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one?
The InChIKey is QTWAGKWYCVOXKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O5/c1-3-10-6-15(22)20-13-7-11(4-5-12(10)13)19-16-9(2)25-14(8-21)17(23)18(16)24/h1,4-7,9,14,16-19,21,23-24H,8H2,2H3,(H,20,22).
What are the key properties of 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one?
7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one has a molecular weight of 344.37 g/mol, XLogP of -0.21, 3 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[[4,5-dihydroxy-6-(hydroxymethyl)-2-methyloxan-3-yl]amino]-4-ethynyl-1H-quinolin-2-one is sourced from PubChem (CID 129100341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).