C12H14N2O — CID 129100499
3-amino-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyridin-2-one (PubChem CID 129100499) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 3-amino-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyridin-2-one.
| Compound Name | 3-amino-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 129100499 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 3-amino-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1H-pyridin-2-one |
| SMILES | C=C/C=C(\C=C/C)c1c[nH]c(=O)c(N)c1 |
| InChI | InChI=1S/C12H14N2O/c1-3-5-9(6-4-2)10-7-11(13)12(15)14-8-10/h3-8H,1,13H2,2H3,(H,14,15)/b6-4-,9-5+ |
| InChIKey | LDTOSCHONCOJHP-QUNSIMLLSA-N |
| XLogP | 2.10 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|