About 2-butan-2-yl-2,6-diazaspiro[4.5]decane
2-butan-2-yl-2,6-diazaspiro[4.5]decane (PubChem CID 129100548) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 2-butan-2-yl-2,6-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 2-butan-2-yl-2,6-diazaspiro[4.5]decane |
| PubChem CID | 129100548 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2-butan-2-yl-2,6-diazaspiro[4.5]decane |
| SMILES | CCC(C)N1CCC2(CCCCN2)C1 |
| InChI | InChI=1S/C12H24N2/c1-3-11(2)14-9-7-12(10-14)6-4-5-8-13-12/h11,13H,3-10H2,1-2H3 |
| InChIKey | XTMDJNAWDXBHKG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butan-2-yl-2,6-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butan-2-yl-2,6-diazaspiro[4.5]decane?
The IUPAC name of 2-butan-2-yl-2,6-diazaspiro[4.5]decane (CID 129100548) is 2-butan-2-yl-2,6-diazaspiro[4.5]decane.
What is the SMILES notation for 2-butan-2-yl-2,6-diazaspiro[4.5]decane?
The canonical SMILES for 2-butan-2-yl-2,6-diazaspiro[4.5]decane is CCC(C)N1CCC2(CCCCN2)C1.
What is the InChIKey of 2-butan-2-yl-2,6-diazaspiro[4.5]decane?
The InChIKey is XTMDJNAWDXBHKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-3-11(2)14-9-7-12(10-14)6-4-5-8-13-12/h11,13H,3-10H2,1-2H3.
What are the key properties of 2-butan-2-yl-2,6-diazaspiro[4.5]decane?
2-butan-2-yl-2,6-diazaspiro[4.5]decane has a molecular weight of 196.34 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yl-2,6-diazaspiro[4.5]decane is sourced from PubChem (CID 129100548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).