C24H26FNO — CID 129100578
(1E,3E)-N-ethenyl-2-(1-ethoxyethenyl)-5-(4-fluorophenyl)-4-methyl-1-phenylpenta-1,3-dien-1-amine (PubChem CID 129100578) has the molecular formula C24H26FNO and a molecular weight of 363.48 g/mol. Its IUPAC name is (1E,3E)-N-ethenyl-2-(1-ethoxyethenyl)-5-(4-fluorophenyl)-4-methyl-1-phenylpenta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-N-ethenyl-2-(1-ethoxyethenyl)-5-(4-fluorophenyl)-4-methyl-1-phenylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 129100578 |
| Molecular Formula | C24H26FNO |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | (1E,3E)-N-ethenyl-2-(1-ethoxyethenyl)-5-(4-fluorophenyl)-4-methyl-1-phenylpenta-1,3-dien-1-amine |
| SMILES | C=CN/C(=C(\C=C(/C)Cc1ccc(F)cc1)C(=C)OCC)c1ccccc1 |
| InChI | InChI=1S/C24H26FNO/c1-5-26-24(21-10-8-7-9-11-21)23(19(4)27-6-2)17-18(3)16-20-12-14-22(25)15-13-20/h5,7-15,17,26H,1,4,6,16H2,2-3H3/b18-17+,24-23+ |
| InChIKey | RBLORNQLNLESLK-QZOSNYCWSA-N |
| XLogP | 6.01 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|