About 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine
4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine (PubChem CID 129100610) has the molecular formula C20H41N3O
and a molecular weight of 339.57 g/mol. Its IUPAC name is 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine.
Molecular Properties
| Compound Name | 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine |
| PubChem CID | 129100610 |
| Molecular Formula | C20H41N3O |
| Molecular Weight | 339.57 g/mol |
| Exact Mass | 339.32 |
| IUPAC Name | 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine |
| SMILES | [H]/N=C(CCC)/C(CCC)=N/C(C)(C)CCOC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C20H41N3O/c1-9-11-16(21)17(12-10-2)23-19(5,6)13-14-24-20(7,8)15-18(3,4)22/h21H,9-15,22H2,1-8H3/b21-16+,23-17+ |
| InChIKey | OBBZQZMFIJLAML-CVFALDEMSA-N |
| XLogP | 5.14 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.57 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine?
The IUPAC name of 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine (CID 129100610) is 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine.
What is the SMILES notation for 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine?
The canonical SMILES for 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine is [H]/N=C(CCC)/C(CCC)=N/C(C)(C)CCOC(C)(C)CC(C)(C)N.
What is the InChIKey of 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine?
The InChIKey is OBBZQZMFIJLAML-CVFALDEMSA-N. The full InChI is InChI=1S/C20H41N3O/c1-9-11-16(21)17(12-10-2)23-19(5,6)13-14-24-20(7,8)15-18(3,4)22/h21H,9-15,22H2,1-8H3/b21-16+,23-17+.
What are the key properties of 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine?
4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine has a molecular weight of 339.57 g/mol, XLogP of 5.14, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(5-iminooctan-4-ylideneamino)-3-methylbutoxy]-2,4-dimethylpentan-2-amine is sourced from PubChem (CID 129100610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).