C26H49N3O — CID 129101262
4-[3-[(1,2-dicyclohexyl-2-iminoethylidene)amino]-3-methylbutoxy]-2,4-dimethylpentan-2-amine (PubChem CID 129101262) has the molecular formula C26H49N3O and a molecular weight of 419.70 g/mol. Its IUPAC name is 4-[3-[(1,2-dicyclohexyl-2-iminoethylidene)amino]-3-methylbutoxy]-2,4-dimethylpentan-2-amine.
| Compound Name | 4-[3-[(1,2-dicyclohexyl-2-iminoethylidene)amino]-3-methylbutoxy]-2,4-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 129101262 |
| Molecular Formula | C26H49N3O |
| Molecular Weight | 419.70 g/mol |
| Exact Mass | 419.39 |
| IUPAC Name | 4-[3-[(1,2-dicyclohexyl-2-iminoethylidene)amino]-3-methylbutoxy]-2,4-dimethylpentan-2-amine |
| SMILES | [H]/N=C(C(=N/C(C)(C)CCOC(C)(C)CC(C)(C)N)/C1CCCCC1)\C1CCCCC1 |
| InChI | InChI=1S/C26H49N3O/c1-24(2,28)19-26(5,6)30-18-17-25(3,4)29-23(21-15-11-8-12-16-21)22(27)20-13-9-7-10-14-20/h20-21,27H,7-19,28H2,1-6H3/b27-22+,29-23+ |
| InChIKey | GQOXFIIOKQQULJ-VAEXLCAJSA-N |
| XLogP | 6.70 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.70 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|