About 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate
2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate (PubChem CID 129101812) has the molecular formula C17H21N3O3
and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate.
Molecular Properties
| Compound Name | 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate |
| PubChem CID | 129101812 |
| Molecular Formula | C17H21N3O3 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate |
| SMILES | COCCOC(=O)c1cc(-c2ncn[nH]2)c(C2CCC2)cc1C |
| InChI | InChI=1S/C17H21N3O3/c1-11-8-14(12-4-3-5-12)15(16-18-10-19-20-16)9-13(11)17(21)23-7-6-22-2/h8-10,12H,3-7H2,1-2H3,(H,18,19,20) |
| InChIKey | OROJTFXZHHTMMO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate?
The IUPAC name of 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate (CID 129101812) is 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate.
What is the SMILES notation for 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate?
The canonical SMILES for 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate is COCCOC(=O)c1cc(-c2ncn[nH]2)c(C2CCC2)cc1C.
What is the InChIKey of 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate?
The InChIKey is OROJTFXZHHTMMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O3/c1-11-8-14(12-4-3-5-12)15(16-18-10-19-20-16)9-13(11)17(21)23-7-6-22-2/h8-10,12H,3-7H2,1-2H3,(H,18,19,20).
What are the key properties of 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate?
2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate has a molecular weight of 315.37 g/mol, XLogP of 2.85, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxyethyl 4-cyclobutyl-2-methyl-5-(1H-1,2,4-triazol-5-yl)benzoate is sourced from PubChem (CID 129101812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).