C13H25N — CID 129102229
(1R,2R,5S)-2-butyl-6,6-dimethylbicyclo[3.1.1]heptan-2-amine (PubChem CID 129102229) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (1R,2R,5S)-2-butyl-6,6-dimethylbicyclo[3.1.1]heptan-2-amine.
| Compound Name | (1R,2R,5S)-2-butyl-6,6-dimethylbicyclo[3.1.1]heptan-2-amine |
|---|---|
| PubChem CID | 129102229 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (1R,2R,5S)-2-butyl-6,6-dimethylbicyclo[3.1.1]heptan-2-amine |
| SMILES | CCCC[C@@]1(N)CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C13H25N/c1-4-5-7-13(14)8-6-10-9-11(13)12(10,2)3/h10-11H,4-9,14H2,1-3H3/t10-,11+,13+/m0/s1 |
| InChIKey | SGBIUTHGXDGYAY-DMDPSCGWSA-N |
| XLogP | 3.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |