C21H23N3O3 — CID 129102383
ethyl (12Z)-5-amino-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaene-15-carboxylate (PubChem CID 129102383) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is ethyl (12Z)-5-amino-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaene-15-carboxylate.
| Compound Name | ethyl (12Z)-5-amino-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaene-15-carboxylate |
|---|---|
| PubChem CID | 129102383 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | ethyl (12Z)-5-amino-9-oxo-8,17-diazatricyclo[14.3.1.02,7]icosa-1(20),2(7),3,5,12,16,18-heptaene-15-carboxylate |
| SMILES | CCOC(=O)C1C/C=C/CCC(=O)Nc2cc(N)ccc2-c2ccnc1c2 |
| InChI | InChI=1S/C21H23N3O3/c1-2-27-21(26)17-6-4-3-5-7-20(25)24-19-13-15(22)8-9-16(19)14-10-11-23-18(17)12-14/h3-4,8-13,17H,2,5-7,22H2,1H3,(H,24,25)/b4-3+ |
| InChIKey | HDPSPLFNLDEBHR-ONEGZZNKSA-N |
| XLogP | 3.66 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|