About [(1R,2S)-2-prop-2-enylcyclohexyl]methanol
[(1R,2S)-2-prop-2-enylcyclohexyl]methanol (PubChem CID 12910245) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is [(1R,2S)-2-prop-2-enylcyclohexyl]methanol.
Molecular Properties
| Compound Name | [(1R,2S)-2-prop-2-enylcyclohexyl]methanol |
| PubChem CID | 12910245 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | [(1R,2S)-2-prop-2-enylcyclohexyl]methanol |
| SMILES | C=CC[C@@H]1CCCC[C@H]1CO |
| InChI | InChI=1S/C10H18O/c1-2-5-9-6-3-4-7-10(9)8-11/h2,9-11H,1,3-8H2/t9-,10+/m1/s1 |
| InChIKey | ALLAJRPGJVFASC-ZJUUUORDSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-prop-2-enylcyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-prop-2-enylcyclohexyl]methanol?
The IUPAC name of [(1R,2S)-2-prop-2-enylcyclohexyl]methanol (CID 12910245) is [(1R,2S)-2-prop-2-enylcyclohexyl]methanol.
What is the SMILES notation for [(1R,2S)-2-prop-2-enylcyclohexyl]methanol?
The canonical SMILES for [(1R,2S)-2-prop-2-enylcyclohexyl]methanol is C=CC[C@@H]1CCCC[C@H]1CO.
What is the InChIKey of [(1R,2S)-2-prop-2-enylcyclohexyl]methanol?
The InChIKey is ALLAJRPGJVFASC-ZJUUUORDSA-N. The full InChI is InChI=1S/C10H18O/c1-2-5-9-6-3-4-7-10(9)8-11/h2,9-11H,1,3-8H2/t9-,10+/m1/s1.
What are the key properties of [(1R,2S)-2-prop-2-enylcyclohexyl]methanol?
[(1R,2S)-2-prop-2-enylcyclohexyl]methanol has a molecular weight of 154.25 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-prop-2-enylcyclohexyl]methanol is sourced from PubChem (CID 12910245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).