C26H31Cl2N3O — CID 129103262
7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one (PubChem CID 129103262) has the molecular formula C26H31Cl2N3O and a molecular weight of 472.46 g/mol. Its IUPAC name is 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one.
| Compound Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one |
|---|---|
| PubChem CID | 129103262 |
| Molecular Formula | C26H31Cl2N3O |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 7-[4-[4-(2,3-dichlorophenyl)piperazin-1-yl]butyl]-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-2-one |
| SMILES | O=C1CCc2cc(CCCCN3CCN(c4cccc(Cl)c4Cl)CC3)cc3c2N1CCC3 |
| InChI | InChI=1S/C26H31Cl2N3O/c27-22-7-3-8-23(25(22)28)30-15-13-29(14-16-30)11-2-1-5-19-17-20-6-4-12-31-24(32)10-9-21(18-19)26(20)31/h3,7-8,17-18H,1-2,4-6,9-16H2 |
| InChIKey | JMNANONYFXPEKD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|