C21H42O4S — CID 129103266
methyl (12R)-12-hydroxy-10-(2-hydroxyethylsulfanyl)octadecanoate (PubChem CID 129103266) has the molecular formula C21H42O4S and a molecular weight of 390.63 g/mol. Its IUPAC name is methyl (12R)-12-hydroxy-10-(2-hydroxyethylsulfanyl)octadecanoate.
| Compound Name | methyl (12R)-12-hydroxy-10-(2-hydroxyethylsulfanyl)octadecanoate |
|---|---|
| PubChem CID | 129103266 |
| Molecular Formula | C21H42O4S |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | methyl (12R)-12-hydroxy-10-(2-hydroxyethylsulfanyl)octadecanoate |
| SMILES | CCCCCC[C@@H](O)CC(CCCCCCCCC(=O)OC)SCCO |
| InChI | InChI=1S/C21H42O4S/c1-3-4-5-10-13-19(23)18-20(26-17-16-22)14-11-8-6-7-9-12-15-21(24)25-2/h19-20,22-23H,3-18H2,1-2H3/t19-,20?/m1/s1 |
| InChIKey | DDSXGMYXPNYBAS-FIWHBWSRSA-N |
| XLogP | 5.10 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|