C23H21ClN6O — CID 129103409
N-(2-chloro-5,6,7,8-tetrahydroquinolin-5-yl)-1-[(2-methylquinolin-6-yl)methyl]triazole-4-carboxamide (PubChem CID 129103409) has the molecular formula C23H21ClN6O and a molecular weight of 432.92 g/mol. Its IUPAC name is N-(2-chloro-5,6,7,8-tetrahydroquinolin-5-yl)-1-[(2-methylquinolin-6-yl)methyl]triazole-4-carboxamide.
| Compound Name | N-(2-chloro-5,6,7,8-tetrahydroquinolin-5-yl)-1-[(2-methylquinolin-6-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 129103409 |
| Molecular Formula | C23H21ClN6O |
| Molecular Weight | 432.92 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-(2-chloro-5,6,7,8-tetrahydroquinolin-5-yl)-1-[(2-methylquinolin-6-yl)methyl]triazole-4-carboxamide |
| SMILES | Cc1ccc2cc(Cn3cc(C(=O)NC4CCCc5nc(Cl)ccc54)nn3)ccc2n1 |
| InChI | InChI=1S/C23H21ClN6O/c1-14-5-7-16-11-15(6-9-18(16)25-14)12-30-13-21(28-29-30)23(31)27-20-4-2-3-19-17(20)8-10-22(24)26-19/h5-11,13,20H,2-4,12H2,1H3,(H,27,31) |
| InChIKey | IRDYSCISPDGSNH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.92 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|