C30H51NO5 — CID 129103415
(3R,6R)-6-[(3S,9R,11R,13R,14S)-11-hydroxy-4,4,9,13,14-pentamethyl-3-nitro-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3-diol (PubChem CID 129103415) has the molecular formula C30H51NO5 and a molecular weight of 505.74 g/mol. Its IUPAC name is (3R,6R)-6-[(3S,9R,11R,13R,14S)-11-hydroxy-4,4,9,13,14-pentamethyl-3-nitro-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3-diol.
| Compound Name | (3R,6R)-6-[(3S,9R,11R,13R,14S)-11-hydroxy-4,4,9,13,14-pentamethyl-3-nitro-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3-diol |
|---|---|
| PubChem CID | 129103415 |
| Molecular Formula | C30H51NO5 |
| Molecular Weight | 505.74 g/mol |
| Exact Mass | 505.38 |
| IUPAC Name | (3R,6R)-6-[(3S,9R,11R,13R,14S)-11-hydroxy-4,4,9,13,14-pentamethyl-3-nitro-2,3,7,8,10,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptane-2,3-diol |
| SMILES | C[C@H](CC[C@@H](O)C(C)(C)O)C1CC[C@@]2(C)C3CC=C4C(CC[C@H]([N+](=O)[O-])C4(C)C)[C@]3(C)[C@H](O)C[C@]12C |
| InChI | InChI=1S/C30H51NO5/c1-18(9-14-24(32)27(4,5)34)19-15-16-28(6)22-12-10-20-21(11-13-23(31(35)36)26(20,2)3)30(22,8)25(33)17-29(19,28)7/h10,18-19,21-25,32-34H,9,11-17H2,1-8H3/t18-,19?,21?,22?,23+,24-,25-,28+,29-,30+/m1/s1 |
| InChIKey | HCLDBDFOUQXQJL-DWZBLDNRSA-N |
| XLogP | 5.76 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.74 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|