C24H26N4O4 — CID 129104766
ethyl 3-[4-(4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbonylamino)-4,5,6,7-tetrahydroindazol-1-yl]benzoate (PubChem CID 129104766) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is ethyl 3-[4-(4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbonylamino)-4,5,6,7-tetrahydroindazol-1-yl]benzoate.
| Compound Name | ethyl 3-[4-(4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbonylamino)-4,5,6,7-tetrahydroindazol-1-yl]benzoate |
|---|---|
| PubChem CID | 129104766 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | ethyl 3-[4-(4,5,6,7-tetrahydro-1,2-benzoxazole-3-carbonylamino)-4,5,6,7-tetrahydroindazol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-n2ncc3c2CCCC3NC(=O)c2noc3c2CCCC3)c1 |
| InChI | InChI=1S/C24H26N4O4/c1-2-31-24(30)15-7-5-8-16(13-15)28-20-11-6-10-19(18(20)14-25-28)26-23(29)22-17-9-3-4-12-21(17)32-27-22/h5,7-8,13-14,19H,2-4,6,9-12H2,1H3,(H,26,29) |
| InChIKey | NPJOEMOBFOQIMX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |