C13H18O8 — CID 129105041
2,2-dimethyl-1,3-dioxane-4,6-dione;2,2,5-trimethyl-1,3-dioxane-4,6-dione (PubChem CID 129105041) has the molecular formula C13H18O8 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-dioxane-4,6-dione;2,2,5-trimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-1,3-dioxane-4,6-dione;2,2,5-trimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 129105041 |
| Molecular Formula | C13H18O8 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 2,2-dimethyl-1,3-dioxane-4,6-dione;2,2,5-trimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)CC(=O)O1.CC1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C7H10O4.C6H8O4/c1-4-5(8)10-7(2,3)11-6(4)9;1-6(2)9-4(7)3-5(8)10-6/h4H,1-3H3;3H2,1-2H3 |
| InChIKey | OIHKBCBVRNEBNT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|