C27H33FN4O — CID 129105409
N-[2-(1-benzylpiperidin-4-yl)ethyl]-N-(3-cyano-4-fluorophenyl)piperidine-4-carboxamide (PubChem CID 129105409) has the molecular formula C27H33FN4O and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[2-(1-benzylpiperidin-4-yl)ethyl]-N-(3-cyano-4-fluorophenyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(1-benzylpiperidin-4-yl)ethyl]-N-(3-cyano-4-fluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 129105409 |
| Molecular Formula | C27H33FN4O |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | N-[2-(1-benzylpiperidin-4-yl)ethyl]-N-(3-cyano-4-fluorophenyl)piperidine-4-carboxamide |
| SMILES | N#Cc1cc(N(CCC2CCN(Cc3ccccc3)CC2)C(=O)C2CCNCC2)ccc1F |
| InChI | InChI=1S/C27H33FN4O/c28-26-7-6-25(18-24(26)19-29)32(27(33)23-8-13-30-14-9-23)17-12-21-10-15-31(16-11-21)20-22-4-2-1-3-5-22/h1-7,18,21,23,30H,8-17,20H2 |
| InChIKey | BDARJCPBJLQVLF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |