About 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane]
3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane] (PubChem CID 129105691) has the molecular formula C19H26O
and a molecular weight of 270.42 g/mol. Its IUPAC name is 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane].
Molecular Properties
| Compound Name | 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane] |
| PubChem CID | 129105691 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane] |
| SMILES | C=C(C)COC1(C)c2ccccc2CC12CCCCC2 |
| InChI | InChI=1S/C19H26O/c1-15(2)14-20-18(3)17-10-6-5-9-16(17)13-19(18)11-7-4-8-12-19/h5-6,9-10H,1,4,7-8,11-14H2,2-3H3 |
| InChIKey | ICVJAHJUEKSCSS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane]?
The IUPAC name of 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane] (CID 129105691) is 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane].
What is the SMILES notation for 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane]?
The canonical SMILES for 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane] is C=C(C)COC1(C)c2ccccc2CC12CCCCC2.
What is the InChIKey of 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane]?
The InChIKey is ICVJAHJUEKSCSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O/c1-15(2)14-20-18(3)17-10-6-5-9-16(17)13-19(18)11-7-4-8-12-19/h5-6,9-10H,1,4,7-8,11-14H2,2-3H3.
What are the key properties of 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane]?
3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane] has a molecular weight of 270.42 g/mol, XLogP of 5.00, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-(2-methylprop-2-enoxy)spiro[1H-indene-2,1'-cyclohexane] is sourced from PubChem (CID 129105691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).