C17H26O — CID 129105711
3-(2,2-dimethylpropoxy)-2,2,3-trimethyl-1H-indene (PubChem CID 129105711) has the molecular formula C17H26O and a molecular weight of 246.39 g/mol. Its IUPAC name is 3-(2,2-dimethylpropoxy)-2,2,3-trimethyl-1H-indene.
| Compound Name | 3-(2,2-dimethylpropoxy)-2,2,3-trimethyl-1H-indene |
|---|---|
| PubChem CID | 129105711 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 3-(2,2-dimethylpropoxy)-2,2,3-trimethyl-1H-indene |
| SMILES | CC(C)(C)COC1(C)c2ccccc2CC1(C)C |
| InChI | InChI=1S/C17H26O/c1-15(2,3)12-18-17(6)14-10-8-7-9-13(14)11-16(17,4)5/h7-10H,11-12H2,1-6H3 |
| InChIKey | RFZKMEQRTRKLGO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |