About 1-bromo-3,5-diethyladamantane
1-bromo-3,5-diethyladamantane (PubChem CID 12910650) has the molecular formula C14H23Br
and a molecular weight of 271.24 g/mol. Its IUPAC name is 1-bromo-3,5-diethyladamantane.
Molecular Properties
| Compound Name | 1-bromo-3,5-diethyladamantane |
| PubChem CID | 12910650 |
| Molecular Formula | C14H23Br |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 1-bromo-3,5-diethyladamantane |
| SMILES | CCC12CC3CC(Br)(C1)CC(CC)(C3)C2 |
| InChI | InChI=1S/C14H23Br/c1-3-12-5-11-6-13(4-2,8-12)10-14(15,7-11)9-12/h11H,3-10H2,1-2H3 |
| InChIKey | JJJHMTZMITZWDM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-3,5-diethyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-3,5-diethyladamantane?
The IUPAC name of 1-bromo-3,5-diethyladamantane (CID 12910650) is 1-bromo-3,5-diethyladamantane.
What is the SMILES notation for 1-bromo-3,5-diethyladamantane?
The canonical SMILES for 1-bromo-3,5-diethyladamantane is CCC12CC3CC(Br)(C1)CC(CC)(C3)C2.
What is the InChIKey of 1-bromo-3,5-diethyladamantane?
The InChIKey is JJJHMTZMITZWDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23Br/c1-3-12-5-11-6-13(4-2,8-12)10-14(15,7-11)9-12/h11H,3-10H2,1-2H3.
What are the key properties of 1-bromo-3,5-diethyladamantane?
1-bromo-3,5-diethyladamantane has a molecular weight of 271.24 g/mol, XLogP of 4.91, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-3,5-diethyladamantane is sourced from PubChem (CID 12910650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).