About 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol
1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol (PubChem CID 129107045) has the molecular formula C18H19FOS
and a molecular weight of 302.41 g/mol. Its IUPAC name is 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol.
Molecular Properties
| Compound Name | 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol |
| PubChem CID | 129107045 |
| Molecular Formula | C18H19FOS |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol |
| SMILES | CC(O)(C#CS(C)(c1ccccc1)c1ccccc1)CF |
| InChI | InChI=1S/C18H19FOS/c1-18(20,15-19)13-14-21(2,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,20H,15H2,1-2H3 |
| InChIKey | CGIVHTBFVSIVFJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol?
The IUPAC name of 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol (CID 129107045) is 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol.
What is the SMILES notation for 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol?
The canonical SMILES for 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol is CC(O)(C#CS(C)(c1ccccc1)c1ccccc1)CF.
What is the InChIKey of 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol?
The InChIKey is CGIVHTBFVSIVFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FOS/c1-18(20,15-19)13-14-21(2,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,20H,15H2,1-2H3.
What are the key properties of 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol?
1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol has a molecular weight of 302.41 g/mol, XLogP of 4.22, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-2-methyl-4-[methyl(diphenyl)-λ4-sulfanyl]but-3-yn-2-ol is sourced from PubChem (CID 129107045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).