C29H31FO5S — CID 129107160
4-[[14-[(3-fluorophenoxy)methyl]-3-methyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxymethyl]-1,1-dioxothian-4-ol (PubChem CID 129107160) has the molecular formula C29H31FO5S and a molecular weight of 510.63 g/mol. Its IUPAC name is 4-[[14-[(3-fluorophenoxy)methyl]-3-methyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxymethyl]-1,1-dioxothian-4-ol.
| Compound Name | 4-[[14-[(3-fluorophenoxy)methyl]-3-methyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxymethyl]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 129107160 |
| Molecular Formula | C29H31FO5S |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 4-[[14-[(3-fluorophenoxy)methyl]-3-methyl-5-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]oxymethyl]-1,1-dioxothian-4-ol |
| SMILES | Cc1cc(OCC2(O)CCS(=O)(=O)CC2)cc2c1-c1cc(COc3cccc(F)c3)ccc1CCC2 |
| InChI | InChI=1S/C29H31FO5S/c1-20-14-26(35-19-29(31)10-12-36(32,33)13-11-29)16-23-5-2-4-22-9-8-21(15-27(22)28(20)23)18-34-25-7-3-6-24(30)17-25/h3,6-9,14-17,31H,2,4-5,10-13,18-19H2,1H3 |
| InChIKey | VLOHHSSOKLLMFO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |