About 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline
4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline (PubChem CID 129107274) has the molecular formula C10H11ClN2O2
and a molecular weight of 226.66 g/mol. Its IUPAC name is 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline.
Molecular Properties
| Compound Name | 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline |
| PubChem CID | 129107274 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline |
| SMILES | COC1=CC2=NC=NC(Cl)C2C=C1OC |
| InChI | InChI=1S/C10H11ClN2O2/c1-14-8-3-6-7(4-9(8)15-2)12-5-13-10(6)11/h3-6,10H,1-2H3 |
| InChIKey | XGYUFZFSBARIAB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline?
The IUPAC name of 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline (CID 129107274) is 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline.
What is the SMILES notation for 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline?
The canonical SMILES for 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline is COC1=CC2=NC=NC(Cl)C2C=C1OC.
What is the InChIKey of 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline?
The InChIKey is XGYUFZFSBARIAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClN2O2/c1-14-8-3-6-7(4-9(8)15-2)12-5-13-10(6)11/h3-6,10H,1-2H3.
What are the key properties of 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline?
4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline has a molecular weight of 226.66 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6,7-dimethoxy-4,4a-dihydroquinazoline is sourced from PubChem (CID 129107274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).