About (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine
(2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine (PubChem CID 129107475) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine.
Molecular Properties
| Compound Name | (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine |
| PubChem CID | 129107475 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine |
| SMILES | CC/N=C/C(=C1/C=CC=CC1)C1CC1 |
| InChI | InChI=1S/C13H17N/c1-2-14-10-13(12-8-9-12)11-6-4-3-5-7-11/h3-6,10,12H,2,7-9H2,1H3/b13-11+,14-10+ |
| InChIKey | IMBYQDWFKOFRPQ-CKNIOMRDSA-N |
| XLogP | 3.30 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine?
The IUPAC name of (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine (CID 129107475) is (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine.
What is the SMILES notation for (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine?
The canonical SMILES for (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine is CC/N=C/C(=C1/C=CC=CC1)C1CC1.
What is the InChIKey of (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine?
The InChIKey is IMBYQDWFKOFRPQ-CKNIOMRDSA-N. The full InChI is InChI=1S/C13H17N/c1-2-14-10-13(12-8-9-12)11-6-4-3-5-7-11/h3-6,10,12H,2,7-9H2,1H3/b13-11+,14-10+.
What are the key properties of (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine?
(2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine has a molecular weight of 187.29 g/mol, XLogP of 3.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-cyclohexa-2,4-dien-1-ylidene-2-cyclopropyl-N-ethylethanimine is sourced from PubChem (CID 129107475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).