C24H29N3O3 — CID 129107502
1-[(1S,4S)-5-[[4-[(3S)-6-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]phenyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethanone (PubChem CID 129107502) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 1-[(1S,4S)-5-[[4-[(3S)-6-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]phenyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethanone.
| Compound Name | 1-[(1S,4S)-5-[[4-[(3S)-6-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]phenyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethanone |
|---|---|
| PubChem CID | 129107502 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 1-[(1S,4S)-5-[[4-[(3S)-6-propan-2-yl-2,3-dihydro-[1,4]dioxino[2,3-b]pyridin-3-yl]phenyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H]2C[C@H]1CN2Cc1ccc([C@H]2COc3ccc(C(C)C)nc3O2)cc1 |
| InChI | InChI=1S/C24H29N3O3/c1-15(2)21-8-9-22-24(25-21)30-23(14-29-22)18-6-4-17(5-7-18)11-26-12-20-10-19(26)13-27(20)16(3)28/h4-9,15,19-20,23H,10-14H2,1-3H3/t19-,20-,23+/m0/s1 |
| InChIKey | QBURXMQVOXAOHO-SXWKCWPCSA-N |
| XLogP | 3.52 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |