C9H14F5NO — CID 129107645
1,1,1,3,3-pentafluoro-2-piperidin-4-ylbutan-2-ol (PubChem CID 129107645) has the molecular formula C9H14F5NO and a molecular weight of 247.21 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-2-piperidin-4-ylbutan-2-ol.
| Compound Name | 1,1,1,3,3-pentafluoro-2-piperidin-4-ylbutan-2-ol |
|---|---|
| PubChem CID | 129107645 |
| Molecular Formula | C9H14F5NO |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-2-piperidin-4-ylbutan-2-ol |
| SMILES | CC(F)(F)C(O)(C1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C9H14F5NO/c1-7(10,11)8(16,9(12,13)14)6-2-4-15-5-3-6/h6,15-16H,2-5H2,1H3 |
| InChIKey | IZLSDHFUMSHWLB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |