About 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene
1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene (PubChem CID 129107758) has the molecular formula C42H26Br4
and a molecular weight of 850.29 g/mol. Its IUPAC name is 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene.
Molecular Properties
| Compound Name | 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene |
| PubChem CID | 129107758 |
| Molecular Formula | C42H26Br4 |
| Molecular Weight | 850.29 g/mol |
| Exact Mass | 845.88 |
| IUPAC Name | 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene |
| SMILES | Brc1cc(Br)c(-c2cc(-c3ccccc3)c(-c3ccccc3)cc2Br)cc1-c1cc(-c2ccccc2)c(-c2ccccc2)cc1Br |
| InChI | InChI=1S/C42H26Br4/c43-39-24-33(29-17-9-3-10-18-29)31(27-13-5-1-6-14-27)21-35(39)37-23-38(42(46)26-41(37)45)36-22-32(28-15-7-2-8-16-28)34(25-40(36)44)30-19-11-4-12-20-30/h1-26H |
| InChIKey | VDAWAFQOTIITGE-UHFFFAOYSA-N |
| XLogP | 14.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 850.29 |
| LogP ≤ 5 | 14.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene?
The IUPAC name of 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene (CID 129107758) is 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene.
What is the SMILES notation for 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene?
The canonical SMILES for 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene is Brc1cc(Br)c(-c2cc(-c3ccccc3)c(-c3ccccc3)cc2Br)cc1-c1cc(-c2ccccc2)c(-c2ccccc2)cc1Br.
What is the InChIKey of 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene?
The InChIKey is VDAWAFQOTIITGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H26Br4/c43-39-24-33(29-17-9-3-10-18-29)31(27-13-5-1-6-14-27)21-35(39)37-23-38(42(46)26-41(37)45)36-22-32(28-15-7-2-8-16-28)34(25-40(36)44)30-19-11-4-12-20-30/h1-26H.
What are the key properties of 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene?
1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene has a molecular weight of 850.29 g/mol, XLogP of 14.74, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dibromo-2,4-bis(2-bromo-4,5-diphenylphenyl)benzene is sourced from PubChem (CID 129107758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).