About 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine
3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine (PubChem CID 129108301) has the molecular formula C9H19F2NO
and a molecular weight of 195.25 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine |
| PubChem CID | 129108301 |
| Molecular Formula | C9H19F2NO |
| Molecular Weight | 195.25 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine |
| SMILES | CC(COC(F)F)CN(C)C(C)C |
| InChI | InChI=1S/C9H19F2NO/c1-7(2)12(4)5-8(3)6-13-9(10)11/h7-9H,5-6H2,1-4H3 |
| InChIKey | IENFMIQCHWIAEU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine?
The IUPAC name of 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine (CID 129108301) is 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine.
What is the SMILES notation for 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine?
The canonical SMILES for 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine is CC(COC(F)F)CN(C)C(C)C.
What is the InChIKey of 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine?
The InChIKey is IENFMIQCHWIAEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F2NO/c1-7(2)12(4)5-8(3)6-13-9(10)11/h7-9H,5-6H2,1-4H3.
What are the key properties of 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine?
3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine has a molecular weight of 195.25 g/mol, XLogP of 2.20, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethoxy)-N,2-dimethyl-N-propan-2-ylpropan-1-amine is sourced from PubChem (CID 129108301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).