C45H91N — CID 129108499
(4S)-N-[2-(2,3-dimethylbutan-2-yl)-3,3,4-trimethylpent-4-enyl]-2,3,3,4,5,5,6,6,7,7,10-undecamethyl-8,8,9-tri(propan-2-yl)undecan-4-amine (PubChem CID 129108499) has the molecular formula C45H91N and a molecular weight of 646.23 g/mol. Its IUPAC name is (4S)-N-[2-(2,3-dimethylbutan-2-yl)-3,3,4-trimethylpent-4-enyl]-2,3,3,4,5,5,6,6,7,7,10-undecamethyl-8,8,9-tri(propan-2-yl)undecan-4-amine.
| Compound Name | (4S)-N-[2-(2,3-dimethylbutan-2-yl)-3,3,4-trimethylpent-4-enyl]-2,3,3,4,5,5,6,6,7,7,10-undecamethyl-8,8,9-tri(propan-2-yl)undecan-4-amine |
|---|---|
| PubChem CID | 129108499 |
| Molecular Formula | C45H91N |
| Molecular Weight | 646.23 g/mol |
| Exact Mass | 645.72 |
| IUPAC Name | (4S)-N-[2-(2,3-dimethylbutan-2-yl)-3,3,4-trimethylpent-4-enyl]-2,3,3,4,5,5,6,6,7,7,10-undecamethyl-8,8,9-tri(propan-2-yl)undecan-4-amine |
| SMILES | C=C(C)C(C)(C)C(CN[C@@](C)(C(C)(C)C(C)C)C(C)(C)C(C)(C)C(C)(C)C(C(C)C)(C(C)C)C(C(C)C)C(C)C)C(C)(C)C(C)C |
| InChI | InChI=1S/C45H91N/c1-29(2)37(30(3)4)45(34(11)12,35(13)14)43(25,26)41(21,22)42(23,24)44(27,40(19,20)33(9)10)46-28-36(38(15,16)31(5)6)39(17,18)32(7)8/h29-30,32-37,46H,5,28H2,1-4,6-27H3/t36?,44-/m0/s1 |
| InChIKey | DCELZKCBCPKNEV-BTOZBONTSA-N |
| XLogP | 14.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.23 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|