About methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate
methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate (PubChem CID 129109210) has the molecular formula C22H30O4
and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate |
| PubChem CID | 129109210 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate |
| SMILES | CCCCCCc1cc2c(cc1OC1(C(=O)OC)CCCC1)C(=O)CC2 |
| InChI | InChI=1S/C22H30O4/c1-3-4-5-6-9-17-14-16-10-11-19(23)18(16)15-20(17)26-22(21(24)25-2)12-7-8-13-22/h14-15H,3-13H2,1-2H3 |
| InChIKey | YXYQZQQNZRPJOC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate?
The IUPAC name of methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate (CID 129109210) is methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate.
What is the SMILES notation for methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate?
The canonical SMILES for methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate is CCCCCCc1cc2c(cc1OC1(C(=O)OC)CCCC1)C(=O)CC2.
What is the InChIKey of methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate?
The InChIKey is YXYQZQQNZRPJOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O4/c1-3-4-5-6-9-17-14-16-10-11-19(23)18(16)15-20(17)26-22(21(24)25-2)12-7-8-13-22/h14-15H,3-13H2,1-2H3.
What are the key properties of methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate?
methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate has a molecular weight of 358.48 g/mol, XLogP of 4.80, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)oxy]cyclopentane-1-carboxylate is sourced from PubChem (CID 129109210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).