C19H25N — CID 129109409
N-[(1Z,3Z,6E)-6-methyl-5-methylideneocta-1,3,6-trienyl]-N-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine (PubChem CID 129109409) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is N-[(1Z,3Z,6E)-6-methyl-5-methylideneocta-1,3,6-trienyl]-N-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine.
| Compound Name | N-[(1Z,3Z,6E)-6-methyl-5-methylideneocta-1,3,6-trienyl]-N-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 129109409 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | N-[(1Z,3Z,6E)-6-methyl-5-methylideneocta-1,3,6-trienyl]-N-[(E)-prop-1-enyl]cyclohexa-1,5-dien-1-amine |
| SMILES | C=C(/C=C\C=C/N(/C=C/C)C1=CCCC=C1)/C(C)=C/C |
| InChI | InChI=1S/C19H25N/c1-5-15-20(19-13-8-7-9-14-19)16-11-10-12-18(4)17(3)6-2/h5-6,8,10-16H,4,7,9H2,1-3H3/b12-10-,15-5+,16-11-,17-6+ |
| InChIKey | RMGOXVYFTIAKHW-QBPUZXAZSA-N |
| XLogP | 5.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|