About 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine
1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine (PubChem CID 129109537) has the molecular formula C11H23N3
and a molecular weight of 197.33 g/mol. Its IUPAC name is 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine |
| PubChem CID | 129109537 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine |
| SMILES | C=C(N)NCCCC(N)C(=C)C(C)C |
| InChI | InChI=1S/C11H23N3/c1-8(2)9(3)11(13)6-5-7-14-10(4)12/h8,11,14H,3-7,12-13H2,1-2H3 |
| InChIKey | VLEUOJMEOLSDQM-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine?
The IUPAC name of 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine (CID 129109537) is 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine.
What is the SMILES notation for 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine?
The canonical SMILES for 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine is C=C(N)NCCCC(N)C(=C)C(C)C.
What is the InChIKey of 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine?
The InChIKey is VLEUOJMEOLSDQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3/c1-8(2)9(3)11(13)6-5-7-14-10(4)12/h8,11,14H,3-7,12-13H2,1-2H3.
What are the key properties of 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine?
1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine has a molecular weight of 197.33 g/mol, XLogP of 1.33, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(1-aminoethenyl)-6-methyl-5-methylideneheptane-1,4-diamine is sourced from PubChem (CID 129109537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).