About (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one
(E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one (PubChem CID 129109690) has the molecular formula C15H16Br2O
and a molecular weight of 372.10 g/mol. Its IUPAC name is (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one |
| PubChem CID | 129109690 |
| Molecular Formula | C15H16Br2O |
| Molecular Weight | 372.10 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/C1=CC(Br)=CC(Br)C1)C1=CCCCC1 |
| InChI | InChI=1S/C15H16Br2O/c16-13-8-11(9-14(17)10-13)6-7-15(18)12-4-2-1-3-5-12/h4,6-8,10,14H,1-3,5,9H2/b7-6+ |
| InChIKey | WWQATGBRQPSOEA-VOTSOKGWSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.10 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one?
The IUPAC name of (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one (CID 129109690) is (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one.
What is the SMILES notation for (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one?
The canonical SMILES for (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one is O=C(/C=C/C1=CC(Br)=CC(Br)C1)C1=CCCCC1.
What is the InChIKey of (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one?
The InChIKey is WWQATGBRQPSOEA-VOTSOKGWSA-N. The full InChI is InChI=1S/C15H16Br2O/c16-13-8-11(9-14(17)10-13)6-7-15(18)12-4-2-1-3-5-12/h4,6-8,10,14H,1-3,5,9H2/b7-6+.
What are the key properties of (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one?
(E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one has a molecular weight of 372.10 g/mol, XLogP of 4.98, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(cyclohexen-1-yl)-3-(3,5-dibromocyclohexa-1,3-dien-1-yl)prop-2-en-1-one is sourced from PubChem (CID 129109690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).