C16H27N3O — CID 129110459
(2Z,4E)-5-(2,8-diazaspiro[4.5]decan-8-yl)-3-methoxyhepta-2,4,6-trien-2-amine (PubChem CID 129110459) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is (2Z,4E)-5-(2,8-diazaspiro[4.5]decan-8-yl)-3-methoxyhepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4E)-5-(2,8-diazaspiro[4.5]decan-8-yl)-3-methoxyhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 129110459 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (2Z,4E)-5-(2,8-diazaspiro[4.5]decan-8-yl)-3-methoxyhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(=C\C(OC)=C(/C)N)N1CCC2(CCNC2)CC1 |
| InChI | InChI=1S/C16H27N3O/c1-4-14(11-15(20-3)13(2)17)19-9-6-16(7-10-19)5-8-18-12-16/h4,11,18H,1,5-10,12,17H2,2-3H3/b14-11+,15-13- |
| InChIKey | MOHCVLURPTYNTL-HKHVJCFFSA-N |
| XLogP | 1.97 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|