About 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate
3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate (PubChem CID 129110532) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate.
Molecular Properties
| Compound Name | 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate |
| PubChem CID | 129110532 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate |
| SMILES | COC(=O)CC(=O)OCC1=CC=CCC=C1 |
| InChI | InChI=1S/C12H14O4/c1-15-11(13)8-12(14)16-9-10-6-4-2-3-5-7-10/h2,4-7H,3,8-9H2,1H3 |
| InChIKey | YZKVDZOOIQHQEY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate?
The IUPAC name of 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate (CID 129110532) is 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate.
What is the SMILES notation for 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate?
The canonical SMILES for 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate is COC(=O)CC(=O)OCC1=CC=CCC=C1.
What is the InChIKey of 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate?
The InChIKey is YZKVDZOOIQHQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-15-11(13)8-12(14)16-9-10-6-4-2-3-5-7-10/h2,4-7H,3,8-9H2,1H3.
What are the key properties of 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate?
3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate has a molecular weight of 222.24 g/mol, XLogP of 1.54, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-(cyclohepta-1,3,6-trien-1-ylmethyl) 1-O-methyl propanedioate is sourced from PubChem (CID 129110532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).