C12H17N5 — CID 129111184
1-(2-tert-butylphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 129111184) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(2-tert-butylphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 129111184 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 1-(2-tert-butylphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | CC(C)(C)c1ccccc1-n1nc(N)nc1N |
| InChI | InChI=1S/C12H17N5/c1-12(2,3)8-6-4-5-7-9(8)17-11(14)15-10(13)16-17/h4-7H,1-3H3,(H4,13,14,15,16) |
| InChIKey | WCTONSUTTDJLQA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |