C21H20N2O6 — CID 129111234
2-[(2-ethyl-6,7-dimethoxy-1-oxoisoquinoline-4-carbonyl)amino]benzoic acid (PubChem CID 129111234) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-[(2-ethyl-6,7-dimethoxy-1-oxoisoquinoline-4-carbonyl)amino]benzoic acid.
| Compound Name | 2-[(2-ethyl-6,7-dimethoxy-1-oxoisoquinoline-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 129111234 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 2-[(2-ethyl-6,7-dimethoxy-1-oxoisoquinoline-4-carbonyl)amino]benzoic acid |
| SMILES | CCn1cc(C(=O)Nc2ccccc2C(=O)O)c2cc(OC)c(OC)cc2c1=O |
| InChI | InChI=1S/C21H20N2O6/c1-4-23-11-15(19(24)22-16-8-6-5-7-12(16)21(26)27)13-9-17(28-2)18(29-3)10-14(13)20(23)25/h5-11H,4H2,1-3H3,(H,22,24)(H,26,27) |
| InChIKey | IRKGNLQCHGQOBX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |