About (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate
(2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate (PubChem CID 129111241) has the molecular formula C19H26N2O5
and a molecular weight of 362.43 g/mol. Its IUPAC name is (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate.
Molecular Properties
| Compound Name | (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate |
| PubChem CID | 129111241 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate |
| SMILES | CCC(C)CNC(=O)Oc1cn(CC)c(=O)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C19H26N2O5/c1-6-12(3)10-20-19(23)26-17-11-21(7-2)18(22)14-9-16(25-5)15(24-4)8-13(14)17/h8-9,11-12H,6-7,10H2,1-5H3,(H,20,23) |
| InChIKey | SGELZNWZBLMVQX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate?
The IUPAC name of (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate (CID 129111241) is (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate.
What is the SMILES notation for (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate?
The canonical SMILES for (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate is CCC(C)CNC(=O)Oc1cn(CC)c(=O)c2cc(OC)c(OC)cc12.
What is the InChIKey of (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate?
The InChIKey is SGELZNWZBLMVQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O5/c1-6-12(3)10-20-19(23)26-17-11-21(7-2)18(22)14-9-16(25-5)15(24-4)8-13(14)17/h8-9,11-12H,6-7,10H2,1-5H3,(H,20,23).
What are the key properties of (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate?
(2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate has a molecular weight of 362.43 g/mol, XLogP of 3.17, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-6,7-dimethoxy-1-oxoisoquinolin-4-yl) N-(2-methylbutyl)carbamate is sourced from PubChem (CID 129111241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).