C23H31NO4S — CID 129111488
methyl 5-[(Z)-3-[(5R)-2-hydroxy-5-[(E,3S)-3-hydroxy-4-methylnon-1-en-6-ynyl]pyrrolidin-1-yl]prop-1-enyl]thiophene-2-carboxylate (PubChem CID 129111488) has the molecular formula C23H31NO4S and a molecular weight of 417.57 g/mol. Its IUPAC name is methyl 5-[(Z)-3-[(5R)-2-hydroxy-5-[(E,3S)-3-hydroxy-4-methylnon-1-en-6-ynyl]pyrrolidin-1-yl]prop-1-enyl]thiophene-2-carboxylate.
| Compound Name | methyl 5-[(Z)-3-[(5R)-2-hydroxy-5-[(E,3S)-3-hydroxy-4-methylnon-1-en-6-ynyl]pyrrolidin-1-yl]prop-1-enyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 129111488 |
| Molecular Formula | C23H31NO4S |
| Molecular Weight | 417.57 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | methyl 5-[(Z)-3-[(5R)-2-hydroxy-5-[(E,3S)-3-hydroxy-4-methylnon-1-en-6-ynyl]pyrrolidin-1-yl]prop-1-enyl]thiophene-2-carboxylate |
| SMILES | CCC#CCC(C)[C@H](O)/C=C/[C@H]1CCC(O)N1C/C=C\c1ccc(C(=O)OC)s1 |
| InChI | InChI=1S/C23H31NO4S/c1-4-5-6-8-17(2)20(25)13-10-18-11-15-22(26)24(18)16-7-9-19-12-14-21(29-19)23(27)28-3/h7,9-10,12-14,17-18,20,22,25-26H,4,8,11,15-16H2,1-3H3/b9-7-,13-10+/t17?,18-,20+,22?/m0/s1 |
| InChIKey | ADDYWRYAHQOZNL-SQRHHSFESA-N |
| XLogP | 3.69 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.57 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|