C12H23N — CID 129112357
(3Z,5E)-N,N,5,6-tetramethylocta-3,5-dien-4-amine (PubChem CID 129112357) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (3Z,5E)-N,N,5,6-tetramethylocta-3,5-dien-4-amine.
| Compound Name | (3Z,5E)-N,N,5,6-tetramethylocta-3,5-dien-4-amine |
|---|---|
| PubChem CID | 129112357 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (3Z,5E)-N,N,5,6-tetramethylocta-3,5-dien-4-amine |
| SMILES | CC/C=C(C(/C)=C(\C)CC)\N(C)C |
| InChI | InChI=1S/C12H23N/c1-7-9-12(13(5)6)11(4)10(3)8-2/h9H,7-8H2,1-6H3/b11-10+,12-9- |
| InChIKey | CPJTZVMAUUKYOI-MWOVLNQWSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|