C19H25ClN4O4S — CID 129112779
6-butoxy-5-[(4-chlorophenyl)methyl]-3-(3-hydroxypropyl)-1-methyl-2-oxoimidazo[4,5-c][1,2,6]thiadiazin-4-one (PubChem CID 129112779) has the molecular formula C19H25ClN4O4S and a molecular weight of 440.95 g/mol. Its IUPAC name is 6-butoxy-5-[(4-chlorophenyl)methyl]-3-(3-hydroxypropyl)-1-methyl-2-oxoimidazo[4,5-c][1,2,6]thiadiazin-4-one.
| Compound Name | 6-butoxy-5-[(4-chlorophenyl)methyl]-3-(3-hydroxypropyl)-1-methyl-2-oxoimidazo[4,5-c][1,2,6]thiadiazin-4-one |
|---|---|
| PubChem CID | 129112779 |
| Molecular Formula | C19H25ClN4O4S |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 6-butoxy-5-[(4-chlorophenyl)methyl]-3-(3-hydroxypropyl)-1-methyl-2-oxoimidazo[4,5-c][1,2,6]thiadiazin-4-one |
| SMILES | CCCCOc1nc2c(n1Cc1ccc(Cl)cc1)C(=O)N(CCCO)S(=O)N2C |
| InChI | InChI=1S/C19H25ClN4O4S/c1-3-4-12-28-19-21-17-16(23(19)13-14-6-8-15(20)9-7-14)18(26)24(10-5-11-25)29(27)22(17)2/h6-9,25H,3-5,10-13H2,1-2H3 |
| InChIKey | SMLRRLZMXUAABU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|