About didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide
didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide (PubChem CID 129113165) has the molecular formula C36H60IN3O4
and a molecular weight of 725.80 g/mol. Its IUPAC name is didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide.
Molecular Properties
| Compound Name | didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide |
| PubChem CID | 129113165 |
| Molecular Formula | C36H60IN3O4 |
| Molecular Weight | 725.80 g/mol |
| Exact Mass | 725.36 |
| IUPAC Name | didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide |
| SMILES | CCCCCCCCCC[N+](C)(CCCCCCCCCC)CC(=O)NC1CCC(=O)N(CC(=O)c2ccccc2)C1=O.[I-] |
| InChI | InChI=1S/C36H59N3O4.HI/c1-4-6-8-10-12-14-16-21-27-39(3,28-22-17-15-13-11-9-7-5-2)30-34(41)37-32-25-26-35(42)38(36(32)43)29-33(40)31-23-19-18-20-24-31;/h18-20,23-24,32H,4-17,21-22,25-30H2,1-3H3;1H |
| InChIKey | AXCYJAQXUPRWOT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 725.80 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide?
The IUPAC name of didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide (CID 129113165) is didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide.
What is the SMILES notation for didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide?
The canonical SMILES for didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide is CCCCCCCCCC[N+](C)(CCCCCCCCCC)CC(=O)NC1CCC(=O)N(CC(=O)c2ccccc2)C1=O.[I-].
What is the InChIKey of didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide?
The InChIKey is AXCYJAQXUPRWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H59N3O4.HI/c1-4-6-8-10-12-14-16-21-27-39(3,28-22-17-15-13-11-9-7-5-2)30-34(41)37-32-25-26-35(42)38(36(32)43)29-33(40)31-23-19-18-20-24-31;/h18-20,23-24,32H,4-17,21-22,25-30H2,1-3H3;1H.
What are the key properties of didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide?
didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide has a molecular weight of 725.80 g/mol, XLogP of 4.24, 24 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for didecyl-[2-[(2,6-dioxo-1-phenacylpiperidin-3-yl)amino]-2-oxoethyl]-methylazanium iodide is sourced from PubChem (CID 129113165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).