C24H26F3N5O5 — CID 129113313
7-[(4-aminophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methoxy]-8,9-dihydropurine-2,6-dione (PubChem CID 129113313) has the molecular formula C24H26F3N5O5 and a molecular weight of 521.50 g/mol. Its IUPAC name is 7-[(4-aminophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methoxy]-8,9-dihydropurine-2,6-dione.
| Compound Name | 7-[(4-aminophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methoxy]-8,9-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 129113313 |
| Molecular Formula | C24H26F3N5O5 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 7-[(4-aminophenyl)methyl]-1-(3-hydroxypropyl)-3-methyl-8-[[3-(trifluoromethoxy)phenyl]methoxy]-8,9-dihydropurine-2,6-dione |
| SMILES | Cn1c2c(c(=O)n(CCCO)c1=O)N(Cc1ccc(N)cc1)C(OCc1cccc(OC(F)(F)F)c1)N2 |
| InChI | InChI=1S/C24H26F3N5O5/c1-30-20-19(21(34)31(23(30)35)10-3-11-33)32(13-15-6-8-17(28)9-7-15)22(29-20)36-14-16-4-2-5-18(12-16)37-24(25,26)27/h2,4-9,12,22,29,33H,3,10-11,13-14,28H2,1H3 |
| InChIKey | ILDSDOCIUADYES-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 123.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|