About 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone
1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone (PubChem CID 129113866) has the molecular formula C15H16N2O
and a molecular weight of 240.31 g/mol. Its IUPAC name is 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone.
Molecular Properties
| Compound Name | 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone |
| PubChem CID | 129113866 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone |
| SMILES | O=C(c1ccccc1)N1CC2CN3C=C1C2CC3 |
| InChI | InChI=1S/C15H16N2O/c18-15(11-4-2-1-3-5-11)17-9-12-8-16-7-6-13(12)14(17)10-16/h1-5,10,12-13H,6-9H2 |
| InChIKey | VEBDKUCJAJFYEW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone?
The IUPAC name of 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone (CID 129113866) is 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone.
What is the SMILES notation for 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone?
The canonical SMILES for 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone is O=C(c1ccccc1)N1CC2CN3C=C1C2CC3.
What is the InChIKey of 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone?
The InChIKey is VEBDKUCJAJFYEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O/c18-15(11-4-2-1-3-5-11)17-9-12-8-16-7-6-13(12)14(17)10-16/h1-5,10,12-13H,6-9H2.
What are the key properties of 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone?
1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone has a molecular weight of 240.31 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazatricyclo[4.3.1.03,7]dec-2-en-4-yl(phenyl)methanone is sourced from PubChem (CID 129113866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).