C21H21ClF2N2O3 — CID 129114132
5-[2,6-difluoro-4-[(1S)-1-(2-methoxyethylamino)ethyl]benzoyl]-2H-isoquinolin-1-one;hydrochloride (PubChem CID 129114132) has the molecular formula C21H21ClF2N2O3 and a molecular weight of 422.86 g/mol. Its IUPAC name is 5-[2,6-difluoro-4-[(1S)-1-(2-methoxyethylamino)ethyl]benzoyl]-2H-isoquinolin-1-one;hydrochloride.
| Compound Name | 5-[2,6-difluoro-4-[(1S)-1-(2-methoxyethylamino)ethyl]benzoyl]-2H-isoquinolin-1-one;hydrochloride |
|---|---|
| PubChem CID | 129114132 |
| Molecular Formula | C21H21ClF2N2O3 |
| Molecular Weight | 422.86 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 5-[2,6-difluoro-4-[(1S)-1-(2-methoxyethylamino)ethyl]benzoyl]-2H-isoquinolin-1-one;hydrochloride |
| SMILES | COCCN[C@@H](C)c1cc(F)c(C(=O)c2cccc3c(=O)[nH]ccc23)c(F)c1.Cl |
| InChI | InChI=1S/C21H20F2N2O3.ClH/c1-12(24-8-9-28-2)13-10-17(22)19(18(23)11-13)20(26)15-4-3-5-16-14(15)6-7-25-21(16)27;/h3-7,10-12,24H,8-9H2,1-2H3,(H,25,27);1H/t12-;/m0./s1 |
| InChIKey | OFNAZQBEVDKMPK-YDALLXLXSA-N |
| XLogP | 3.76 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.86 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|