C27H32FN5O3S — CID 129114803
1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)cyclohexane-1-carboxamide (PubChem CID 129114803) has the molecular formula C27H32FN5O3S and a molecular weight of 525.65 g/mol. Its IUPAC name is 1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)cyclohexane-1-carboxamide.
| Compound Name | 1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 129114803 |
| Molecular Formula | C27H32FN5O3S |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.22 |
| IUPAC Name | 1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)cyclohexane-1-carboxamide |
| SMILES | C[C@H]1CC[C@H](c2ccccc2)S(=O)(=O)N1Cc1ccc(C2(C(N)=O)CCC(n3cnnc3)CC2)cc1F |
| InChI | InChI=1S/C27H32FN5O3S/c1-19-7-10-25(20-5-3-2-4-6-20)37(35,36)33(19)16-21-8-9-22(15-24(21)28)27(26(29)34)13-11-23(12-14-27)32-17-30-31-18-32/h2-6,8-9,15,17-19,23,25H,7,10-14,16H2,1H3,(H2,29,34)/t19-,23?,25+,27?/m0/s1 |
| InChIKey | NCFGTORLOISXNV-ZHJFKZHYSA-N |
| XLogP | 4.01 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |