C27H32F2N4O3S — CID 129115014
[1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)cyclohexyl]methanol (PubChem CID 129115014) has the molecular formula C27H32F2N4O3S and a molecular weight of 530.64 g/mol. Its IUPAC name is [1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)cyclohexyl]methanol.
| Compound Name | [1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)cyclohexyl]methanol |
|---|---|
| PubChem CID | 129115014 |
| Molecular Formula | C27H32F2N4O3S |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | [1-[2,5-difluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-4-(1,2,4-triazol-4-yl)cyclohexyl]methanol |
| SMILES | C[C@H]1CC[C@H](c2ccccc2)S(=O)(=O)N1Cc1cc(F)c(C2(CO)CCC(n3cnnc3)CC2)cc1F |
| InChI | InChI=1S/C27H32F2N4O3S/c1-19-7-8-26(20-5-3-2-4-6-20)37(35,36)33(19)15-21-13-25(29)23(14-24(21)28)27(16-34)11-9-22(10-12-27)32-17-30-31-18-32/h2-6,13-14,17-19,22,26,34H,7-12,15-16H2,1H3/t19-,22?,26+,27?/m0/s1 |
| InChIKey | RNHDNXIYOMAJPU-ZKFZIASKSA-N |
| XLogP | 4.66 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |